C13H21N5O2 — CID 13157690
1-butyl-3-(6-morpholin-4-ylpyridazin-3-yl)urea (PubChem CID 13157690) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-butyl-3-(6-morpholin-4-ylpyridazin-3-yl)urea.
| Compound Name | 1-butyl-3-(6-morpholin-4-ylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 13157690 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-butyl-3-(6-morpholin-4-ylpyridazin-3-yl)urea |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCOCC2)nn1 |
| InChI | InChI=1S/C13H21N5O2/c1-2-3-6-14-13(19)15-11-4-5-12(17-16-11)18-7-9-20-10-8-18/h4-5H,2-3,6-10H2,1H3,(H2,14,15,16,19) |
| InChIKey | ACDUDQSZSCLFRH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|