C12H25BO2 — CID 13157908
5-hexyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 13157908) has the molecular formula C12H25BO2 and a molecular weight of 212.14 g/mol. Its IUPAC name is 5-hexyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | 5-hexyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 13157908 |
| Molecular Formula | C12H25BO2 |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 5-hexyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CCCCCCC1COB(C(C)C)OC1 |
| InChI | InChI=1S/C12H25BO2/c1-4-5-6-7-8-12-9-14-13(11(2)3)15-10-12/h11-12H,4-10H2,1-3H3 |
| InChIKey | IMVUHVPKVVLYAA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|