C10H21BO2 — CID 13157951
4,4,6,6-tetramethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 13157951) has the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | 4,4,6,6-tetramethyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 13157951 |
| Molecular Formula | C10H21BO2 |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4,4,6,6-tetramethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC(C)B1OC(C)(C)CC(C)(C)O1 |
| InChI | InChI=1S/C10H21BO2/c1-8(2)11-12-9(3,4)7-10(5,6)13-11/h8H,7H2,1-6H3 |
| InChIKey | LFYNHMOPUAALCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|