About 2,3-dimethylbutanenitrile
2,3-dimethylbutanenitrile (PubChem CID 13158036) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 2,3-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 2,3-dimethylbutanenitrile |
| PubChem CID | 13158036 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 2,3-dimethylbutanenitrile |
| SMILES | CC(C)C(C)C#N |
| InChI | InChI=1S/C6H11N/c1-5(2)6(3)4-7/h5-6H,1-3H3 |
| InChIKey | ZMRCOHMOBLASFC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutanenitrile?
The IUPAC name of 2,3-dimethylbutanenitrile (CID 13158036) is 2,3-dimethylbutanenitrile.
What is the SMILES notation for 2,3-dimethylbutanenitrile?
The canonical SMILES for 2,3-dimethylbutanenitrile is CC(C)C(C)C#N.
What is the InChIKey of 2,3-dimethylbutanenitrile?
The InChIKey is ZMRCOHMOBLASFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-5(2)6(3)4-7/h5-6H,1-3H3.
What are the key properties of 2,3-dimethylbutanenitrile?
2,3-dimethylbutanenitrile has a molecular weight of 97.16 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutanenitrile is sourced from PubChem (CID 13158036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).