C8H4ClF2NO3 — CID 131580406
2-chloro-1-(2,3-difluoro-4-nitrophenyl)ethanone (PubChem CID 131580406) has the molecular formula C8H4ClF2NO3 and a molecular weight of 235.57 g/mol. Its IUPAC name is 2-chloro-1-(2,3-difluoro-4-nitrophenyl)ethanone.
| Compound Name | 2-chloro-1-(2,3-difluoro-4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 131580406 |
| Molecular Formula | C8H4ClF2NO3 |
| Molecular Weight | 235.57 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 2-chloro-1-(2,3-difluoro-4-nitrophenyl)ethanone |
| SMILES | O=C(CCl)c1ccc([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C8H4ClF2NO3/c9-3-6(13)4-1-2-5(12(14)15)8(11)7(4)10/h1-2H,3H2 |
| InChIKey | MGQLWQYXASWWLK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|