About 2-butyladamantan-2-amine
2-butyladamantan-2-amine (PubChem CID 13158052) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 2-butyladamantan-2-amine.
Molecular Properties
| Compound Name | 2-butyladamantan-2-amine |
| PubChem CID | 13158052 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2-butyladamantan-2-amine |
| SMILES | CCCCC1(N)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H25N/c1-2-3-4-14(15)12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,2-9,15H2,1H3 |
| InChIKey | AETRMEAALJJLHQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyladamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyladamantan-2-amine?
The IUPAC name of 2-butyladamantan-2-amine (CID 13158052) is 2-butyladamantan-2-amine.
What is the SMILES notation for 2-butyladamantan-2-amine?
The canonical SMILES for 2-butyladamantan-2-amine is CCCCC1(N)C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-butyladamantan-2-amine?
The InChIKey is AETRMEAALJJLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-2-3-4-14(15)12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,2-9,15H2,1H3.
What are the key properties of 2-butyladamantan-2-amine?
2-butyladamantan-2-amine has a molecular weight of 207.36 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyladamantan-2-amine is sourced from PubChem (CID 13158052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).