C9H6BrF3O3 — CID 131586702
(2R)-2-[2-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 131586702) has the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. Its IUPAC name is (2R)-2-[2-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | (2R)-2-[2-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 131586702 |
| Molecular Formula | C9H6BrF3O3 |
| Molecular Weight | 299.04 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | (2R)-2-[2-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)[C@H](O)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C9H6BrF3O3/c10-6-2-1-4(9(11,12)13)3-5(6)7(14)8(15)16/h1-3,7,14H,(H,15,16)/t7-/m1/s1 |
| InChIKey | PADXAIUBOAXZPD-SSDOTTSWSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.04 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |