C10H9NO2 — CID 131587924
1-(2,3-dihydroxyphenyl)cyclopropane-1-carbonitrile (PubChem CID 131587924) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(2,3-dihydroxyphenyl)cyclopropane-1-carbonitrile.
| Compound Name | 1-(2,3-dihydroxyphenyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 131587924 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-(2,3-dihydroxyphenyl)cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C10H9NO2/c11-6-10(4-5-10)7-2-1-3-8(12)9(7)13/h1-3,12-13H,4-5H2 |
| InChIKey | FGIULRQHGWRZIX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|