About 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine
3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine (PubChem CID 131589047) has the molecular formula C8H6FN3OS
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 131589047 |
| Molecular Formula | C8H6FN3OS |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(Oc2ccccc2F)ns1 |
| InChI | InChI=1S/C8H6FN3OS/c9-5-3-1-2-4-6(5)13-8-11-7(10)14-12-8/h1-4H,(H2,10,11,12) |
| InChIKey | XFIVMZBTPUWCCL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine (CID 131589047) is 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine is Nc1nc(Oc2ccccc2F)ns1.
What is the InChIKey of 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine?
The InChIKey is XFIVMZBTPUWCCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3OS/c9-5-3-1-2-4-6(5)13-8-11-7(10)14-12-8/h1-4H,(H2,10,11,12).
What are the key properties of 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine?
3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine has a molecular weight of 211.22 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenoxy)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 131589047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).