C11H11NO2 — CID 13159069
(4-methyl-1,3-oxazol-2-yl)-phenylmethanol (PubChem CID 13159069) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (4-methyl-1,3-oxazol-2-yl)-phenylmethanol.
| Compound Name | (4-methyl-1,3-oxazol-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 13159069 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (4-methyl-1,3-oxazol-2-yl)-phenylmethanol |
| SMILES | Cc1coc(C(O)c2ccccc2)n1 |
| InChI | InChI=1S/C11H11NO2/c1-8-7-14-11(12-8)10(13)9-5-3-2-4-6-9/h2-7,10,13H,1H3 |
| InChIKey | KDLDCGPGRZCPFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |