About 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane
3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane (PubChem CID 13159085) has the molecular formula C16H32OSi
and a molecular weight of 268.52 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane.
Molecular Properties
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane |
| PubChem CID | 13159085 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane |
| SMILES | C=CC(C)(CCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H32OSi/c1-8-16(7,14-12-13-15(5)6)17-18(9-2,10-3)11-4/h8,13H,1,9-12,14H2,2-7H3 |
| InChIKey | ZQWLZEYUJYXVAY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane?
The IUPAC name of 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane (CID 13159085) is 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane.
What is the SMILES notation for 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane?
The canonical SMILES for 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane is C=CC(C)(CCC=C(C)C)O[Si](CC)(CC)CC.
What is the InChIKey of 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane?
The InChIKey is ZQWLZEYUJYXVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32OSi/c1-8-16(7,14-12-13-15(5)6)17-18(9-2,10-3)11-4/h8,13H,1,9-12,14H2,2-7H3.
What are the key properties of 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane?
3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane has a molecular weight of 268.52 g/mol, XLogP of 5.70, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-1,6-dien-3-yloxy(triethyl)silane is sourced from PubChem (CID 13159085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).