About [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane
[4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane (PubChem CID 13159091) has the molecular formula C17H30OSi2
and a molecular weight of 306.60 g/mol. Its IUPAC name is [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane |
| PubChem CID | 13159091 |
| Molecular Formula | C17H30OSi2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C(C23CC4CC(CC(C4)C2)C3)O[Si]1(C)C |
| InChI | InChI=1S/C17H30OSi2/c1-19(2,3)16-15(18-20(16,4)5)17-9-12-6-13(10-17)8-14(7-12)11-17/h12-14H,6-11H2,1-5H3 |
| InChIKey | QXCAPVARGZRQGZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane?
The IUPAC name of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane (CID 13159091) is [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane.
What is the SMILES notation for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane?
The canonical SMILES for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane is C[Si](C)(C)C1=C(C23CC4CC(CC(C4)C2)C3)O[Si]1(C)C.
What is the InChIKey of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane?
The InChIKey is QXCAPVARGZRQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30OSi2/c1-19(2,3)16-15(18-20(16,4)5)17-9-12-6-13(10-17)8-14(7-12)11-17/h12-14H,6-11H2,1-5H3.
What are the key properties of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane?
[4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane has a molecular weight of 306.60 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-trimethylsilane is sourced from PubChem (CID 13159091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).