About 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine
6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine (PubChem CID 131597471) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine.
Analyze 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The IUPAC name of 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine (CID 131597471) is 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The canonical SMILES for 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine is CC1Cn2nccc2CN1.
What is the InChIKey of 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The InChIKey is PJJXRZRLBMRDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-6-5-10-7(4-8-6)2-3-9-10/h2-3,6,8H,4-5H2,1H3.
What are the key properties of 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine has a molecular weight of 137.19 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 131597471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).