C7H7F3IN3O — CID 131601200
3-(aminomethyl)-2-iodo-6-(trifluoromethoxy)pyridin-4-amine (PubChem CID 131601200) has the molecular formula C7H7F3IN3O and a molecular weight of 333.05 g/mol. Its IUPAC name is 3-(aminomethyl)-2-iodo-6-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 3-(aminomethyl)-2-iodo-6-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 131601200 |
| Molecular Formula | C7H7F3IN3O |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 3-(aminomethyl)-2-iodo-6-(trifluoromethoxy)pyridin-4-amine |
| SMILES | NCc1c(N)cc(OC(F)(F)F)nc1I |
| InChI | InChI=1S/C7H7F3IN3O/c8-7(9,10)15-5-1-4(13)3(2-12)6(11)14-5/h1H,2,12H2,(H2,13,14) |
| InChIKey | QELBGMBUFXODNA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|