About 5H-pyrido[3,2-b]pyrrolizine
5H-pyrido[3,2-b]pyrrolizine (PubChem CID 13160532) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5H-pyrido[3,2-b]pyrrolizine.
Molecular Properties
| Compound Name | 5H-pyrido[3,2-b]pyrrolizine |
| PubChem CID | 13160532 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 5H-pyrido[3,2-b]pyrrolizine |
| SMILES | c1cnc2c(c1)Cc1cccn1-2 |
| InChI | InChI=1S/C10H8N2/c1-3-8-7-9-4-2-6-12(9)10(8)11-5-1/h1-6H,7H2 |
| InChIKey | UKWKLHLTASXIOL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrido[3,2-b]pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[3,2-b]pyrrolizine?
The IUPAC name of 5H-pyrido[3,2-b]pyrrolizine (CID 13160532) is 5H-pyrido[3,2-b]pyrrolizine.
What is the SMILES notation for 5H-pyrido[3,2-b]pyrrolizine?
The canonical SMILES for 5H-pyrido[3,2-b]pyrrolizine is c1cnc2c(c1)Cc1cccn1-2.
What is the InChIKey of 5H-pyrido[3,2-b]pyrrolizine?
The InChIKey is UKWKLHLTASXIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-3-8-7-9-4-2-6-12(9)10(8)11-5-1/h1-6H,7H2.
What are the key properties of 5H-pyrido[3,2-b]pyrrolizine?
5H-pyrido[3,2-b]pyrrolizine has a molecular weight of 156.19 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[3,2-b]pyrrolizine is sourced from PubChem (CID 13160532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).