About 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one
2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one (PubChem CID 131606917) has the molecular formula C8H7BrOS
and a molecular weight of 231.11 g/mol. Its IUPAC name is 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one.
Molecular Properties
| Compound Name | 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one |
| PubChem CID | 131606917 |
| Molecular Formula | C8H7BrOS |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one |
| SMILES | CC1Cc2cc(Br)sc2C1=O |
| InChI | InChI=1S/C8H7BrOS/c1-4-2-5-3-6(9)11-8(5)7(4)10/h3-4H,2H2,1H3 |
| InChIKey | GDJNYYYECRBXNV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The IUPAC name of 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one (CID 131606917) is 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one.
What is the SMILES notation for 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The canonical SMILES for 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one is CC1Cc2cc(Br)sc2C1=O.
What is the InChIKey of 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The InChIKey is GDJNYYYECRBXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrOS/c1-4-2-5-3-6(9)11-8(5)7(4)10/h3-4H,2H2,1H3.
What are the key properties of 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one has a molecular weight of 231.11 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-methyl-4,5-dihydrocyclopenta[b]thiophen-6-one is sourced from PubChem (CID 131606917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).