5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride

C9H7Cl2NO2S — CID 131607001

IUPAC5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride
SMILESCCc1cc(Cl)cc(S(=O)(=O)Cl)c1C#N
InChIInChI=1S/C9H7Cl2NO2S/c1-2-6-3-7(10)4-9(8(6)5-12)15(11,13)14/h3-4H,2H2,1H3
InChIKeyORIIXKQBCUQGFR-UHFFFAOYSA-N
MW264.13 g/mol
LogP2.70
Rot. Bonds2

About 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride

5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride (PubChem CID 131607001) has the molecular formula C9H7Cl2NO2S and a molecular weight of 264.13 g/mol. Its IUPAC name is 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride.

Molecular Properties

Compound Name5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride
PubChem CID131607001
Molecular FormulaC9H7Cl2NO2S
Molecular Weight264.13 g/mol
Exact Mass262.96
IUPAC Name5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride
SMILESCCc1cc(Cl)cc(S(=O)(=O)Cl)c1C#N
InChIInChI=1S/C9H7Cl2NO2S/c1-2-6-3-7(10)4-9(8(6)5-12)15(11,13)14/h3-4H,2H2,1H3
InChIKeyORIIXKQBCUQGFR-UHFFFAOYSA-N
XLogP2.70
TPSA57.93 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.13
LogP ≤ 52.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride?
The IUPAC name of 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride (CID 131607001) is 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride.
What is the SMILES notation for 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride?
The canonical SMILES for 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride is CCc1cc(Cl)cc(S(=O)(=O)Cl)c1C#N.
What is the InChIKey of 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride?
The InChIKey is ORIIXKQBCUQGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO2S/c1-2-6-3-7(10)4-9(8(6)5-12)15(11,13)14/h3-4H,2H2,1H3.
What are the key properties of 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride?
5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride has a molecular weight of 264.13 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-cyano-3-ethylbenzenesulfonyl chloride is sourced from PubChem (CID 131607001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).