C11H15BrFNO — CID 131611189
6-[(1R)-1-amino-2,2-dimethylpropyl]-2-bromo-3-fluorophenol (PubChem CID 131611189) has the molecular formula C11H15BrFNO and a molecular weight of 276.15 g/mol. Its IUPAC name is 6-[(1R)-1-amino-2,2-dimethylpropyl]-2-bromo-3-fluorophenol.
| Compound Name | 6-[(1R)-1-amino-2,2-dimethylpropyl]-2-bromo-3-fluorophenol |
|---|---|
| PubChem CID | 131611189 |
| Molecular Formula | C11H15BrFNO |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 6-[(1R)-1-amino-2,2-dimethylpropyl]-2-bromo-3-fluorophenol |
| SMILES | CC(C)(C)[C@@H](N)c1ccc(F)c(Br)c1O |
| InChI | InChI=1S/C11H15BrFNO/c1-11(2,3)10(14)6-4-5-7(13)8(12)9(6)15/h4-5,10,15H,14H2,1-3H3/t10-/m0/s1 |
| InChIKey | PHEJLRYHLIZXAE-JTQLQIEISA-N |
| XLogP | 3.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|