About pyrazolo[5,1-a]isoquinolin-2-ylmethanol
pyrazolo[5,1-a]isoquinolin-2-ylmethanol (PubChem CID 13161784) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is pyrazolo[5,1-a]isoquinolin-2-ylmethanol.
Molecular Properties
| Compound Name | pyrazolo[5,1-a]isoquinolin-2-ylmethanol |
| PubChem CID | 13161784 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | pyrazolo[5,1-a]isoquinolin-2-ylmethanol |
| SMILES | OCc1cc2c3ccccc3ccn2n1 |
| InChI | InChI=1S/C12H10N2O/c15-8-10-7-12-11-4-2-1-3-9(11)5-6-14(12)13-10/h1-7,15H,8H2 |
| InChIKey | DTSWXVGCDJGVML-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[5,1-a]isoquinolin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[5,1-a]isoquinolin-2-ylmethanol?
The IUPAC name of pyrazolo[5,1-a]isoquinolin-2-ylmethanol (CID 13161784) is pyrazolo[5,1-a]isoquinolin-2-ylmethanol.
What is the SMILES notation for pyrazolo[5,1-a]isoquinolin-2-ylmethanol?
The canonical SMILES for pyrazolo[5,1-a]isoquinolin-2-ylmethanol is OCc1cc2c3ccccc3ccn2n1.
What is the InChIKey of pyrazolo[5,1-a]isoquinolin-2-ylmethanol?
The InChIKey is DTSWXVGCDJGVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-8-10-7-12-11-4-2-1-3-9(11)5-6-14(12)13-10/h1-7,15H,8H2.
What are the key properties of pyrazolo[5,1-a]isoquinolin-2-ylmethanol?
pyrazolo[5,1-a]isoquinolin-2-ylmethanol has a molecular weight of 198.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[5,1-a]isoquinolin-2-ylmethanol is sourced from PubChem (CID 13161784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).