C8H2BrN3O2S — CID 131621426
2-bromo-6-nitro-1,3-benzothiazole-5-carbonitrile (PubChem CID 131621426) has the molecular formula C8H2BrN3O2S and a molecular weight of 284.09 g/mol. Its IUPAC name is 2-bromo-6-nitro-1,3-benzothiazole-5-carbonitrile.
| Compound Name | 2-bromo-6-nitro-1,3-benzothiazole-5-carbonitrile |
|---|---|
| PubChem CID | 131621426 |
| Molecular Formula | C8H2BrN3O2S |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 282.91 |
| IUPAC Name | 2-bromo-6-nitro-1,3-benzothiazole-5-carbonitrile |
| SMILES | N#Cc1cc2nc(Br)sc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H2BrN3O2S/c9-8-11-5-1-4(3-10)6(12(13)14)2-7(5)15-8/h1-2H |
| InChIKey | OQWZEMXLGUTBPN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|