About 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid
2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid (PubChem CID 1316238) has the molecular formula C23H16N2O5
and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid |
| PubChem CID | 1316238 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C23H16N2O5/c26-20(24-19-9-5-4-8-17(19)23(29)30)15-10-11-16-18(12-15)22(28)25(21(16)27)13-14-6-2-1-3-7-14/h1-12H,13H2,(H,24,26)(H,29,30) |
| InChIKey | GQEVVWHZGOCRCN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_acid_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The IUPAC name of 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid (CID 1316238) is 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid is O=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O.
What is the InChIKey of 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The InChIKey is GQEVVWHZGOCRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O5/c26-20(24-19-9-5-4-8-17(19)23(29)30)15-10-11-16-18(12-15)22(28)25(21(16)27)13-14-6-2-1-3-7-14/h1-12H,13H2,(H,24,26)(H,29,30).
What are the key properties of 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid has a molecular weight of 400.39 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-benzyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid is sourced from PubChem (CID 1316238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).