C14H6Cl4N2O2 — CID 13162759
1,5-diamino-2,4,6,8-tetrachloroanthracene-9,10-dione (PubChem CID 13162759) has the molecular formula C14H6Cl4N2O2 and a molecular weight of 376.03 g/mol. Its IUPAC name is 1,5-diamino-2,4,6,8-tetrachloroanthracene-9,10-dione.
| Compound Name | 1,5-diamino-2,4,6,8-tetrachloroanthracene-9,10-dione |
|---|---|
| PubChem CID | 13162759 |
| Molecular Formula | C14H6Cl4N2O2 |
| Molecular Weight | 376.03 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 1,5-diamino-2,4,6,8-tetrachloroanthracene-9,10-dione |
| SMILES | Nc1c(Cl)cc(Cl)c2c1C(=O)c1c(Cl)cc(Cl)c(N)c1C2=O |
| InChI | InChI=1S/C14H6Cl4N2O2/c15-3-1-5(17)11(19)9-7(3)13(21)10-8(14(9)22)4(16)2-6(18)12(10)20/h1-2H,19-20H2 |
| InChIKey | LBZKZHPJFBLXLS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|