About (2-oxo-1H-pyridin-4-yl) acetate
(2-oxo-1H-pyridin-4-yl) acetate (PubChem CID 13163112) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is (2-oxo-1H-pyridin-4-yl) acetate.
Molecular Properties
| Compound Name | (2-oxo-1H-pyridin-4-yl) acetate |
| PubChem CID | 13163112 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | (2-oxo-1H-pyridin-4-yl) acetate |
| SMILES | CC(=O)Oc1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C7H7NO3/c1-5(9)11-6-2-3-8-7(10)4-6/h2-4H,1H3,(H,8,10) |
| InChIKey | MGPHSYZQLLOQKC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-1H-pyridin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1H-pyridin-4-yl) acetate?
The IUPAC name of (2-oxo-1H-pyridin-4-yl) acetate (CID 13163112) is (2-oxo-1H-pyridin-4-yl) acetate.
What is the SMILES notation for (2-oxo-1H-pyridin-4-yl) acetate?
The canonical SMILES for (2-oxo-1H-pyridin-4-yl) acetate is CC(=O)Oc1cc[nH]c(=O)c1.
What is the InChIKey of (2-oxo-1H-pyridin-4-yl) acetate?
The InChIKey is MGPHSYZQLLOQKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c1-5(9)11-6-2-3-8-7(10)4-6/h2-4H,1H3,(H,8,10).
What are the key properties of (2-oxo-1H-pyridin-4-yl) acetate?
(2-oxo-1H-pyridin-4-yl) acetate has a molecular weight of 153.14 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1H-pyridin-4-yl) acetate is sourced from PubChem (CID 13163112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).