C7H14N2O3 — CID 131632145
N-[[(2R,3R,4S)-4-amino-3-hydroxyoxolan-2-yl]methyl]acetamide (PubChem CID 131632145) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is N-[[(2R,3R,4S)-4-amino-3-hydroxyoxolan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R,3R,4S)-4-amino-3-hydroxyoxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 131632145 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | N-[[(2R,3R,4S)-4-amino-3-hydroxyoxolan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1OC[C@H](N)[C@H]1O |
| InChI | InChI=1S/C7H14N2O3/c1-4(10)9-2-6-7(11)5(8)3-12-6/h5-7,11H,2-3,8H2,1H3,(H,9,10)/t5-,6+,7+/m0/s1 |
| InChIKey | VBXVTHZKPBZQDB-RRKCRQDMSA-N |
| XLogP | -1.79 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |