C18H25NO4 — CID 131632731
(3aR,5R,6R,6aS)-2,2-dimethyl-5-[[(2R)-2-phenylpyrrolidin-1-yl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 131632731) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3aR,5R,6R,6aS)-2,2-dimethyl-5-[[(2R)-2-phenylpyrrolidin-1-yl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aS)-2,2-dimethyl-5-[[(2R)-2-phenylpyrrolidin-1-yl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 131632731 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (3aR,5R,6R,6aS)-2,2-dimethyl-5-[[(2R)-2-phenylpyrrolidin-1-yl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CN3CCC[C@@H]3c3ccccc3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2)22-16-15(20)14(21-17(16)23-18)11-19-10-6-9-13(19)12-7-4-3-5-8-12/h3-5,7-8,13-17,20H,6,9-11H2,1-2H3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | FXRSTNMDEDRDHF-OVYGPGRDSA-N |
| XLogP | 2.06 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |