C19H23N3O3 — CID 131632944
(4R,4aS,7S,7aR,12bS)-7-hydrazinyl-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 131632944) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-7-hydrazinyl-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-7-hydrazinyl-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 131632944 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-7-hydrazinyl-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](NN)C=C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C19H23N3O3/c1-2-8-22-9-7-18-15-11-3-4-13(23)16(15)25-17(18)12(21-20)5-6-19(18,24)14(22)10-11/h2-6,12,14,17,21,23-24H,1,7-10,20H2/t12-,14+,17-,18-,19+/m0/s1 |
| InChIKey | AQJDCEPLERSANS-YIBUMMLISA-N |
| XLogP | 0.34 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|