C15H19N3O4 — CID 131633001
(2R,3S,4R,5R,6R)-5-amino-2-(hydroxymethyl)-6-(5-phenyl-1H-imidazol-2-yl)oxane-3,4-diol (PubChem CID 131633001) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-5-amino-2-(hydroxymethyl)-6-(5-phenyl-1H-imidazol-2-yl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6R)-5-amino-2-(hydroxymethyl)-6-(5-phenyl-1H-imidazol-2-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 131633001 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-amino-2-(hydroxymethyl)-6-(5-phenyl-1H-imidazol-2-yl)oxane-3,4-diol |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C15H19N3O4/c16-11-13(21)12(20)10(7-19)22-14(11)15-17-6-9(18-15)8-4-2-1-3-5-8/h1-6,10-14,19-21H,7,16H2,(H,17,18)/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | XNWVPLWFFIGCKG-DHGKCCLASA-N |
| XLogP | -0.44 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |