C8H9N9 — CID 1316345
1-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 1316345) has the molecular formula C8H9N9 and a molecular weight of 231.22 g/mol. Its IUPAC name is 1-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 1316345 |
| Molecular Formula | C8H9N9 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1cc(-n2nc(N)nc2N)n2ncnc2n1 |
| InChI | InChI=1S/C8H9N9/c1-4-2-5(16-7(10)14-6(9)15-16)17-8(13-4)11-3-12-17/h2-3H,1H3,(H4,9,10,14,15) |
| InChIKey | VOLLLKJBQRNVFI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |