About (4-methylsulfanylphenyl) propanoate
(4-methylsulfanylphenyl) propanoate (PubChem CID 131635477) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is (4-methylsulfanylphenyl) propanoate.
Molecular Properties
| Compound Name | (4-methylsulfanylphenyl) propanoate |
| PubChem CID | 131635477 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (4-methylsulfanylphenyl) propanoate |
| SMILES | CCC(=O)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C10H12O2S/c1-3-10(11)12-8-4-6-9(13-2)7-5-8/h4-7H,3H2,1-2H3 |
| InChIKey | WYPVLVXZQULUBC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylsulfanylphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylsulfanylphenyl) propanoate?
The IUPAC name of (4-methylsulfanylphenyl) propanoate (CID 131635477) is (4-methylsulfanylphenyl) propanoate.
What is the SMILES notation for (4-methylsulfanylphenyl) propanoate?
The canonical SMILES for (4-methylsulfanylphenyl) propanoate is CCC(=O)Oc1ccc(SC)cc1.
What is the InChIKey of (4-methylsulfanylphenyl) propanoate?
The InChIKey is WYPVLVXZQULUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-3-10(11)12-8-4-6-9(13-2)7-5-8/h4-7H,3H2,1-2H3.
What are the key properties of (4-methylsulfanylphenyl) propanoate?
(4-methylsulfanylphenyl) propanoate has a molecular weight of 196.27 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylsulfanylphenyl) propanoate is sourced from PubChem (CID 131635477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).