About 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine
2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine (PubChem CID 131635625) has the molecular formula C26H40N2O3
and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine |
| PubChem CID | 131635625 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine |
| SMILES | CCCCCCOC[C@H](COCc1cccc(-c2ccccn2)n1)OCCCCCC |
| InChI | InChI=1S/C26H40N2O3/c1-3-5-7-11-18-29-21-24(31-19-12-8-6-4-2)22-30-20-23-14-13-16-26(28-23)25-15-9-10-17-27-25/h9-10,13-17,24H,3-8,11-12,18-22H2,1-2H3/t24-/m1/s1 |
| InChIKey | IZEABOBGVFICOX-XMMPIXPASA-N |
| XLogP | 6.22 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine?
The IUPAC name of 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine (CID 131635625) is 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine.
What is the SMILES notation for 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine?
The canonical SMILES for 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine is CCCCCCOC[C@H](COCc1cccc(-c2ccccn2)n1)OCCCCCC.
What is the InChIKey of 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine?
The InChIKey is IZEABOBGVFICOX-XMMPIXPASA-N. The full InChI is InChI=1S/C26H40N2O3/c1-3-5-7-11-18-29-21-24(31-19-12-8-6-4-2)22-30-20-23-14-13-16-26(28-23)25-15-9-10-17-27-25/h9-10,13-17,24H,3-8,11-12,18-22H2,1-2H3/t24-/m1/s1.
What are the key properties of 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine?
2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine has a molecular weight of 428.62 g/mol, XLogP of 6.22, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2,3-dihexoxypropoxy]methyl]-6-pyridin-2-ylpyridine is sourced from PubChem (CID 131635625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).