C20H22N2OS — CID 13163583
4-(2-phenyl-3,4-dihydro-2H-1,6-benzothiazocin-5-yl)morpholine (PubChem CID 13163583) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-(2-phenyl-3,4-dihydro-2H-1,6-benzothiazocin-5-yl)morpholine.
| Compound Name | 4-(2-phenyl-3,4-dihydro-2H-1,6-benzothiazocin-5-yl)morpholine |
|---|---|
| PubChem CID | 13163583 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-(2-phenyl-3,4-dihydro-2H-1,6-benzothiazocin-5-yl)morpholine |
| SMILES | c1ccc(C2CC/C(N3CCOCC3)=N\c3ccccc3S2)cc1 |
| InChI | InChI=1S/C20H22N2OS/c1-2-6-16(7-3-1)18-10-11-20(22-12-14-23-15-13-22)21-17-8-4-5-9-19(17)24-18/h1-9,18H,10-15H2/b21-20+ |
| InChIKey | FDABZFCTMKKPMP-QZQOTICOSA-N |
| XLogP | 4.68 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |