C19H21F2N3O3 — CID 131635929
N-[[3-(difluoromethoxy)phenyl]methyl]-3-methoxy-4-pyrazolidin-4-ylbenzamide (PubChem CID 131635929) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-3-methoxy-4-pyrazolidin-4-ylbenzamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-3-methoxy-4-pyrazolidin-4-ylbenzamide |
|---|---|
| PubChem CID | 131635929 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-3-methoxy-4-pyrazolidin-4-ylbenzamide |
| SMILES | COc1cc(C(=O)NCc2cccc(OC(F)F)c2)ccc1C1CNNC1 |
| InChI | InChI=1S/C19H21F2N3O3/c1-26-17-8-13(5-6-16(17)14-10-23-24-11-14)18(25)22-9-12-3-2-4-15(7-12)27-19(20)21/h2-8,14,19,23-24H,9-11H2,1H3,(H,22,25) |
| InChIKey | IISVAMDRVNKZBK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |