C20H19Cl2N3O — CID 131636294
(6R)-3-(3,4-dichlorophenyl)-6-methyl-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 131636294) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is (6R)-3-(3,4-dichlorophenyl)-6-methyl-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | (6R)-3-(3,4-dichlorophenyl)-6-methyl-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 131636294 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (6R)-3-(3,4-dichlorophenyl)-6-methyl-1-(2-methyl-4-pyridinyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | Cc1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)n3c2CCO[C@H](C)C3)ccn1 |
| InChI | InChI=1S/C20H19Cl2N3O/c1-12-9-14(5-7-23-12)19-18-6-8-26-13(2)11-25(18)20(24-19)15-3-4-16(21)17(22)10-15/h3-5,7,9-10,13H,6,8,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZWAONSUCMQPECT-CYBMUJFWSA-N |
| XLogP | 5.19 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |