C22H23ClFN3O — CID 131636301
(6S)-3-(4-chloro-3-methylphenyl)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 131636301) has the molecular formula C22H23ClFN3O and a molecular weight of 399.90 g/mol. Its IUPAC name is (6S)-3-(4-chloro-3-methylphenyl)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | (6S)-3-(4-chloro-3-methylphenyl)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 131636301 |
| Molecular Formula | C22H23ClFN3O |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (6S)-3-(4-chloro-3-methylphenyl)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | Cc1cc(-c2nc(-c3ccc(Cl)c(C)c3)n3c2CCO[C@H](CF)C3)cc(C)n1 |
| InChI | InChI=1S/C22H23ClFN3O/c1-13-8-16(4-5-19(13)23)22-26-21(17-9-14(2)25-15(3)10-17)20-6-7-28-18(11-24)12-27(20)22/h4-5,8-10,18H,6-7,11-12H2,1-3H3/t18-/m1/s1 |
| InChIKey | PIMUUSPQZZBEST-GOSISDBHSA-N |
| XLogP | 5.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |