C23H20F4N4O2 — CID 131636416
5-[(6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile (PubChem CID 131636416) has the molecular formula C23H20F4N4O2 and a molecular weight of 460.43 g/mol. Its IUPAC name is 5-[(6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile.
| Compound Name | 5-[(6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 131636416 |
| Molecular Formula | C23H20F4N4O2 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 5-[(6S)-1-(2,6-dimethyl-4-pyridinyl)-6-(fluoromethyl)-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-(trifluoromethoxy)benzonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)c(C#N)c3)n3c2CCO[C@H](CF)C3)cc(C)n1 |
| InChI | InChI=1S/C23H20F4N4O2/c1-13-7-16(8-14(2)29-13)21-19-5-6-32-18(10-24)12-31(19)22(30-21)15-3-4-20(17(9-15)11-28)33-23(25,26)27/h3-4,7-9,18H,5-6,10,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | XEHQUSUNPCVWGP-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |