C28H27F8NO6S — CID 131636475
4-[(3S)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 131636475) has the molecular formula C28H27F8NO6S and a molecular weight of 657.58 g/mol. Its IUPAC name is 4-[(3S)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3S)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 131636475 |
| Molecular Formula | C28H27F8NO6S |
| Molecular Weight | 657.58 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | 4-[(3S)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)[C@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C3(O)CCC(C(=O)O)CC3)C2)ccc1F |
| InChI | InChI=1S/C28H27F8NO6S/c1-16-14-20(6-7-21(16)29)44(42,43)25(18-2-4-19(5-3-18)26(30,27(31,32)33)28(34,35)36)12-13-37(15-25)23(40)24(41)10-8-17(9-11-24)22(38)39/h2-7,14,17,41H,8-13,15H2,1H3,(H,38,39)/t17?,24?,25-/m1/s1 |
| InChIKey | UETHJQAVQPVEBU-XPBUXGOKSA-N |
| XLogP | 5.33 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |