About 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride
6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride (PubChem CID 131637567) has the molecular formula C11H15ClN2O
and a molecular weight of 226.71 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride |
| PubChem CID | 131637567 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride |
| SMILES | CC1(C)CC(=O)Nc2ccc(N)cc21.Cl |
| InChI | InChI=1S/C11H14N2O.ClH/c1-11(2)6-10(14)13-9-4-3-7(12)5-8(9)11;/h3-5H,6,12H2,1-2H3,(H,13,14);1H |
| InChIKey | GUEAZBYTEFPFGE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride?
The IUPAC name of 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride (CID 131637567) is 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride.
What is the SMILES notation for 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride?
The canonical SMILES for 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride is CC1(C)CC(=O)Nc2ccc(N)cc21.Cl.
What is the InChIKey of 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride?
The InChIKey is GUEAZBYTEFPFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O.ClH/c1-11(2)6-10(14)13-9-4-3-7(12)5-8(9)11;/h3-5H,6,12H2,1-2H3,(H,13,14);1H.
What are the key properties of 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride?
6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride has a molecular weight of 226.71 g/mol, XLogP of 2.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,4-dimethyl-1,3-dihydroquinolin-2-one;hydrochloride is sourced from PubChem (CID 131637567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).