About 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride
6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride (PubChem CID 131637863) has the molecular formula C12H15ClFNO
and a molecular weight of 243.71 g/mol. Its IUPAC name is 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride.
Molecular Properties
| Compound Name | 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride |
| PubChem CID | 131637863 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride |
| SMILES | Cl.Fc1ccc2c(c1)NCC21CCOCC1 |
| InChI | InChI=1S/C12H14FNO.ClH/c13-9-1-2-10-11(7-9)14-8-12(10)3-5-15-6-4-12;/h1-2,7,14H,3-6,8H2;1H |
| InChIKey | OXOCUNFWDZCWOF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride?
The IUPAC name of 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride (CID 131637863) is 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride.
What is the SMILES notation for 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride?
The canonical SMILES for 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride is Cl.Fc1ccc2c(c1)NCC21CCOCC1.
What is the InChIKey of 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride?
The InChIKey is OXOCUNFWDZCWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO.ClH/c13-9-1-2-10-11(7-9)14-8-12(10)3-5-15-6-4-12;/h1-2,7,14H,3-6,8H2;1H.
What are the key properties of 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride?
6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride has a molecular weight of 243.71 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[1,2-dihydroindole-3,4'-oxane];hydrochloride is sourced from PubChem (CID 131637863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).