C6H10ClF2NO — CID 131638047
(3aR,6aR)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole;hydrochloride (PubChem CID 131638047) has the molecular formula C6H10ClF2NO and a molecular weight of 185.60 g/mol. Its IUPAC name is (3aR,6aR)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aR)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 131638047 |
| Molecular Formula | C6H10ClF2NO |
| Molecular Weight | 185.60 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | (3aR,6aR)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole;hydrochloride |
| SMILES | Cl.FC1(F)CO[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C6H9F2NO.ClH/c7-6(8)3-10-5-2-9-1-4(5)6;/h4-5,9H,1-3H2;1H/t4-,5+;/m1./s1 |
| InChIKey | HGSSADDQUHBKPU-JBUOLDKXSA-N |
| XLogP | 0.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.60 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |