About 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane
1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane (PubChem CID 131638198) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane |
| PubChem CID | 131638198 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane |
| SMILES | c1cnc(N2CCC23CCNC3)nc1 |
| InChI | InChI=1S/C10H14N4/c1-4-12-9(13-5-1)14-7-3-10(14)2-6-11-8-10/h1,4-5,11H,2-3,6-8H2 |
| InChIKey | MPZXXHNDSUOMKN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane?
The IUPAC name of 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane (CID 131638198) is 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane.
What is the SMILES notation for 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane?
The canonical SMILES for 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane is c1cnc(N2CCC23CCNC3)nc1.
What is the InChIKey of 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane?
The InChIKey is MPZXXHNDSUOMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-4-12-9(13-5-1)14-7-3-10(14)2-6-11-8-10/h1,4-5,11H,2-3,6-8H2.
What are the key properties of 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane?
1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane has a molecular weight of 190.25 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrimidin-2-yl-1,7-diazaspiro[3.4]octane is sourced from PubChem (CID 131638198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).