C15H20FN5O — CID 131638423
2-(5-fluoropyrimidin-2-yl)-9-methyl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one (PubChem CID 131638423) has the molecular formula C15H20FN5O and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(5-fluoropyrimidin-2-yl)-9-methyl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one.
| Compound Name | 2-(5-fluoropyrimidin-2-yl)-9-methyl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 131638423 |
| Molecular Formula | C15H20FN5O |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-(5-fluoropyrimidin-2-yl)-9-methyl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
| SMILES | C=CCN1CCN(C)C(=O)C12CCN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C15H20FN5O/c1-3-5-21-8-7-19(2)13(22)15(21)4-6-20(11-15)14-17-9-12(16)10-18-14/h3,9-10H,1,4-8,11H2,2H3 |
| InChIKey | KMHBNUPUXPOHDN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|