About 2-cyclobutylpropanedial
2-cyclobutylpropanedial (PubChem CID 13163940) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-cyclobutylpropanedial.
Molecular Properties
| Compound Name | 2-cyclobutylpropanedial |
| PubChem CID | 13163940 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-cyclobutylpropanedial |
| SMILES | O=CC(C=O)C1CCC1 |
| InChI | InChI=1S/C7H10O2/c8-4-7(5-9)6-2-1-3-6/h4-7H,1-3H2 |
| InChIKey | RESHBFIIRDMULK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylpropanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylpropanedial?
The IUPAC name of 2-cyclobutylpropanedial (CID 13163940) is 2-cyclobutylpropanedial.
What is the SMILES notation for 2-cyclobutylpropanedial?
The canonical SMILES for 2-cyclobutylpropanedial is O=CC(C=O)C1CCC1.
What is the InChIKey of 2-cyclobutylpropanedial?
The InChIKey is RESHBFIIRDMULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c8-4-7(5-9)6-2-1-3-6/h4-7H,1-3H2.
What are the key properties of 2-cyclobutylpropanedial?
2-cyclobutylpropanedial has a molecular weight of 126.15 g/mol, XLogP of 0.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylpropanedial is sourced from PubChem (CID 13163940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).