About [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone
[2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone (PubChem CID 131639584) has the molecular formula C19H27N3O2
and a molecular weight of 329.44 g/mol. Its IUPAC name is [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone |
| PubChem CID | 131639584 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC2(CCN(CC3CCOC3)C2)C1 |
| InChI | InChI=1S/C19H27N3O2/c23-18(17-3-1-7-20-11-17)22-8-2-5-19(15-22)6-9-21(14-19)12-16-4-10-24-13-16/h1,3,7,11,16H,2,4-6,8-10,12-15H2 |
| InChIKey | MZOGYFJYFPKPQI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone?
The IUPAC name of [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone (CID 131639584) is [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone.
What is the SMILES notation for [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone?
The canonical SMILES for [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone is O=C(c1cccnc1)N1CCCC2(CCN(CC3CCOC3)C2)C1.
What is the InChIKey of [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone?
The InChIKey is MZOGYFJYFPKPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2/c23-18(17-3-1-7-20-11-17)22-8-2-5-19(15-22)6-9-21(14-19)12-16-4-10-24-13-16/h1,3,7,11,16H,2,4-6,8-10,12-15H2.
What are the key properties of [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone?
[2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone has a molecular weight of 329.44 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(oxolan-3-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]-pyridin-3-ylmethanone is sourced from PubChem (CID 131639584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).