C20H29N3O2 — CID 131640587
[2-[(6-methyl-2-pyridinyl)methyl]-2-azaspiro[4.4]nonan-9-yl]-(oxazinan-2-yl)methanone (PubChem CID 131640587) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is [2-[(6-methyl-2-pyridinyl)methyl]-2-azaspiro[4.4]nonan-9-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [2-[(6-methyl-2-pyridinyl)methyl]-2-azaspiro[4.4]nonan-9-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 131640587 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [2-[(6-methyl-2-pyridinyl)methyl]-2-azaspiro[4.4]nonan-9-yl]-(oxazinan-2-yl)methanone |
| SMILES | Cc1cccc(CN2CCC3(CCCC3C(=O)N3CCCCO3)C2)n1 |
| InChI | InChI=1S/C20H29N3O2/c1-16-6-4-7-17(21-16)14-22-12-10-20(15-22)9-5-8-18(20)19(24)23-11-2-3-13-25-23/h4,6-7,18H,2-3,5,8-15H2,1H3 |
| InChIKey | INIVVPBLGMPUPM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |