C32H28N4 — CID 13164082
2,3,8,9-tetraphenyl-1,4,7,10-tetrazacyclododeca-1,3,7,9-tetraene (PubChem CID 13164082) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2,3,8,9-tetraphenyl-1,4,7,10-tetrazacyclododeca-1,3,7,9-tetraene.
| Compound Name | 2,3,8,9-tetraphenyl-1,4,7,10-tetrazacyclododeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 13164082 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2,3,8,9-tetraphenyl-1,4,7,10-tetrazacyclododeca-1,3,7,9-tetraene |
| SMILES | c1ccc(C2=NCC/N=C(c3ccccc3)\C(c3ccccc3)=N\CC/N=C/2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N4/c1-5-13-25(14-6-1)29-30(26-15-7-2-8-16-26)34-23-24-36-32(28-19-11-4-12-20-28)31(35-22-21-33-29)27-17-9-3-10-18-27/h1-20H,21-24H2/b33-29-,34-30+,35-31?,36-32+ |
| InChIKey | CGIQWQPZAIATSQ-IMJOKVDRSA-N |
| XLogP | 5.96 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |