C17H21FN4OS — CID 131641394
N-(5-fluoropyrimidin-2-yl)-9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine (PubChem CID 131641394) has the molecular formula C17H21FN4OS and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine.
| Compound Name | N-(5-fluoropyrimidin-2-yl)-9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 131641394 |
| Molecular Formula | C17H21FN4OS |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-9-(thiophen-3-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
| SMILES | Fc1cnc(NC2COC3(CCCN(Cc4ccsc4)C3)C2)nc1 |
| InChI | InChI=1S/C17H21FN4OS/c18-14-7-19-16(20-8-14)21-15-6-17(23-10-15)3-1-4-22(12-17)9-13-2-5-24-11-13/h2,5,7-8,11,15H,1,3-4,6,9-10,12H2,(H,19,20,21) |
| InChIKey | OBHLCDRQUBATGK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |