C17H22N2O2S — CID 131642420
3-(2-methyl-1,3-thiazol-4-yl)-4-(2-phenylmethoxyethyl)morpholine (PubChem CID 131642420) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-4-(2-phenylmethoxyethyl)morpholine.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-4-(2-phenylmethoxyethyl)morpholine |
|---|---|
| PubChem CID | 131642420 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-4-(2-phenylmethoxyethyl)morpholine |
| SMILES | Cc1nc(C2COCCN2CCOCc2ccccc2)cs1 |
| InChI | InChI=1S/C17H22N2O2S/c1-14-18-16(13-22-14)17-12-21-10-8-19(17)7-9-20-11-15-5-3-2-4-6-15/h2-6,13,17H,7-12H2,1H3 |
| InChIKey | OKXSWXQSXCCMTQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|