C14H18N2O3 — CID 131645770
9-(furan-3-carbonyl)-1,9-diazaspiro[4.6]undecan-2-one (PubChem CID 131645770) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 9-(furan-3-carbonyl)-1,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | 9-(furan-3-carbonyl)-1,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 131645770 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 9-(furan-3-carbonyl)-1,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1CCC2(CCCN(C(=O)c3ccoc3)CC2)N1 |
| InChI | InChI=1S/C14H18N2O3/c17-12-2-5-14(15-12)4-1-7-16(8-6-14)13(18)11-3-9-19-10-11/h3,9-10H,1-2,4-8H2,(H,15,17) |
| InChIKey | OETYTZFWQIFLBF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |