C19H23FN4O — CID 131646650
7-[(4-fluorophenyl)methyl]-N-methyl-N-pyrimidin-2-yl-1-oxa-7-azaspiro[4.4]nonan-3-amine (PubChem CID 131646650) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-N-methyl-N-pyrimidin-2-yl-1-oxa-7-azaspiro[4.4]nonan-3-amine.
| Compound Name | 7-[(4-fluorophenyl)methyl]-N-methyl-N-pyrimidin-2-yl-1-oxa-7-azaspiro[4.4]nonan-3-amine |
|---|---|
| PubChem CID | 131646650 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-N-methyl-N-pyrimidin-2-yl-1-oxa-7-azaspiro[4.4]nonan-3-amine |
| SMILES | CN(c1ncccn1)C1COC2(CCN(Cc3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C19H23FN4O/c1-23(18-21-8-2-9-22-18)17-11-19(25-13-17)7-10-24(14-19)12-15-3-5-16(20)6-4-15/h2-6,8-9,17H,7,10-14H2,1H3 |
| InChIKey | INVIMSHVIRPIMG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |