C21H24N4O3 — CID 131646713
8-N-phenyl-2-N-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxamide (PubChem CID 131646713) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 8-N-phenyl-2-N-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxamide.
| Compound Name | 8-N-phenyl-2-N-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxamide |
|---|---|
| PubChem CID | 131646713 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 8-N-phenyl-2-N-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxamide |
| SMILES | O=C(Nc1cccnc1)C1CCC2(CCN(C(=O)Nc3ccccc3)CC2)O1 |
| InChI | InChI=1S/C21H24N4O3/c26-19(23-17-7-4-12-22-15-17)18-8-9-21(28-18)10-13-25(14-11-21)20(27)24-16-5-2-1-3-6-16/h1-7,12,15,18H,8-11,13-14H2,(H,23,26)(H,24,27) |
| InChIKey | SWZQCASCNSGUKH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |